Difference between revisions of "Tiso gene 2957"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_2957 == * right end position: ** 17836 * transcription direction: ** POSITIVE * left end position: ** 16260 * centisome position: ** 90.706...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Gene Tiso_gene_2957 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 17836
−
* common name:
+
* transcription direction:
−
** dIDP
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
** 16260
−
* molecular weight:
+
* centisome position:
−
** 409.165    
+
** 90.70624    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.145-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14228]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12693]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12747]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12789]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-342]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-350]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-353]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY66-378]]
 +
* [[PWY-7299]]
 +
* [[PWY-6948]]
 +
* [[PWY-6946]]
 +
* [[PWY-6944]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=17836}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB03536
+
{{#set: left end position=16260}}
−
* CHEBI:
+
{{#set: centisome position=90.70624   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: reaction associated=1.1.1.145-RXN|RXN-12693|RXN-12747|RXN-12789|RXN66-342|RXN66-350|RXN66-353}}
−
* BIGG : didp
+
{{#set: pathway associated=PWY66-378|PWY-7299|PWY-6948|PWY-6946|PWY-6944}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: common name=dIDP}}
+
−
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
−
{{#set: molecular weight=409.165   }}
+
−
{{#set: common name=deoxyinosine diphosphate}}
+
−
{{#set: reversible reaction associated=RXN-14228}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_2957

  • right end position:
    • 17836
  • transcription direction:
    • POSITIVE
  • left end position:
    • 16260
  • centisome position:
    • 90.70624
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2957&oldid=45380"