Difference between revisions of "CPD-506"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12647 CPD-12647] == * smiles: ** CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** D-myo-inositol (1,3,4,5)-tetrakisphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 492.013 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** Ins(1,3,4,5)P4 |
− | ** | + | ** inositol (1,3,4,5)-tetrakisphosphate |
− | ** ( | + | ** 1D-myo-inositol (1,3,4,5)-tetrakisphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8730]] |
+ | * [[3.1.3.62-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2.7.1.139-RXN]] |
+ | * [[2.7.1.127-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01272 C01272] | ||
+ | * HMDB : HMDB01059 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57895 57895] | ||
+ | * METABOLIGHTS : MTBLC57895 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24742076 24742076] |
− | {{#set: smiles= | + | {{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} |
− | {{#set: | + | {{#set: common name=D-myo-inositol (1,3,4,5)-tetrakisphosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=492.013 }} |
− | {{#set: common name=( | + | {{#set: common name=Ins(1,3,4,5)P4|inositol (1,3,4,5)-tetrakisphosphate|1D-myo-inositol (1,3,4,5)-tetrakisphosphate}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-8730|3.1.3.62-RXN}} |
− | {{#set: produced by=RXN- | + | {{#set: produced by=2.7.1.139-RXN|2.7.1.127-RXN}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-506
- smiles:
- C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
- common name:
- D-myo-inositol (1,3,4,5)-tetrakisphosphate
- inchi key:
- InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F
- molecular weight:
- 492.013
- Synonym(s):
- Ins(1,3,4,5)P4
- inositol (1,3,4,5)-tetrakisphosphate
- 1D-myo-inositol (1,3,4,5)-tetrakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.