Difference between revisions of "CPD-506"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4241 RXN-4241] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == |
− | * | + | * smiles: |
− | ** | + | ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) |
− | * | + | * common name: |
− | ** | + | ** D-myo-inositol (1,3,4,5)-tetrakisphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F | ||
+ | * molecular weight: | ||
+ | ** 492.013 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Ins(1,3,4,5)P4 | ||
+ | ** inositol (1,3,4,5)-tetrakisphosphate | ||
+ | ** 1D-myo-inositol (1,3,4,5)-tetrakisphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-8730]] |
− | + | * [[3.1.3.62-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.7.1.139-RXN]] | |
− | + | * [[2.7.1.127-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01272 C01272] |
− | {{#set: | + | * HMDB : HMDB01059 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57895 57895] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57895 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24742076 24742076] |
− | {{#set: | + | {{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} |
+ | {{#set: common name=D-myo-inositol (1,3,4,5)-tetrakisphosphate}} | ||
+ | {{#set: inchi key=InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F}} | ||
+ | {{#set: molecular weight=492.013 }} | ||
+ | {{#set: common name=Ins(1,3,4,5)P4|inositol (1,3,4,5)-tetrakisphosphate|1D-myo-inositol (1,3,4,5)-tetrakisphosphate}} | ||
+ | {{#set: consumed by=RXN-8730|3.1.3.62-RXN}} | ||
+ | {{#set: produced by=2.7.1.139-RXN|2.7.1.127-RXN}} |
Revision as of 14:47, 21 March 2018
Contents
Metabolite CPD-506
- smiles:
- C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
- common name:
- D-myo-inositol (1,3,4,5)-tetrakisphosphate
- inchi key:
- InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F
- molecular weight:
- 492.013
- Synonym(s):
- Ins(1,3,4,5)P4
- inositol (1,3,4,5)-tetrakisphosphate
- 1D-myo-inositol (1,3,4,5)-tetrakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.