Difference between revisions of "Tiso gene 19198"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxyhexanoyl-ACPs R-3-hydroxyhexanoyl-ACPs] == * common name: ** a (3R)-3-hydroxyhexanoy...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxyhexanoyl-ACPs R-3-hydroxyhexanoyl-ACPs] ==
−
* smiles:
+
−
** C(C(=O)[O-])N(C)C(N)=[N+]
+
−
* inchi key:
+
−
** InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** creatine
+
** a (3R)-3-hydroxyhexanoyl-[acp]
−
* molecular weight:
+
−
** 131.134   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methylguanidinoacetic acid
+
** a β-hydroxyhexanoyl-[acp]
−
** N-amidinosarcosine
+
−
** methylglycocyamine
+
−
** N-methyl-N-guanylglycine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[CREATINASE-RXN]]
+
* [[RXN-9520]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9518]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 57-00-1
+
{{#set: common name=a (3R)-3-hydroxyhexanoyl-[acp]}}
−
* PUBCHEM:
+
{{#set: common name=a β-hydroxyhexanoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058172 7058172]
+
{{#set: consumed by=RXN-9520}}
−
* HMDB : HMDB00064
+
{{#set: produced by=RXN-9518}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00300 C00300]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5414502.html 5414502]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57947 57947]
+
−
* METABOLIGHTS : MTBLC57947
+
−
{{#set: smiles=C(C(=O)[O-])N(C)C(N)=[N+]}}
+
−
{{#set: inchi key=InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N}}
+
−
{{#set: common name=creatine}}
+
−
{{#set: molecular weight=131.134    }}
+
−
{{#set: common name=methylguanidinoacetic acid|N-amidinosarcosine|methylglycocyamine|N-methyl-N-guanylglycine}}
+
−
{{#set: consumed by=CREATINASE-RXN}}
+

Revision as of 15:05, 21 March 2018

Metabolite R-3-hydroxyhexanoyl-ACPs

  • common name:
    • a (3R)-3-hydroxyhexanoyl-[acp]
  • Synonym(s):
    • a β-hydroxyhexanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxyhexanoyl-[acp" cannot be used as a page name in this wiki.
"a β-hydroxyhexanoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19198&oldid=32246"