Difference between revisions of "Tiso gene 19424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Gene == Gene Tiso_gene_19077 == * left end position: ** 49 * transcription direction: ** POSITIVE * right end position: ** 2181 * centisome position: ** 1.8838909...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19077 == |
− | * | + | * left end position: |
− | ** | + | ** 49 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2181 |
− | * | + | * centisome position: |
− | ** | + | ** 1.8838909 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN0-2601]] | |
− | * [[ | + | ** in-silico_annotation |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=49}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2181}} | |
− | + | {{#set: centisome position=1.8838909 }} | |
− | + | {{#set: reaction associated=RXN0-2601}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 17:22, 10 January 2018
Gene Tiso_gene_19077
- left end position:
- 49
- transcription direction:
- POSITIVE
- right end position:
- 2181
- centisome position:
- 1.8838909
- Synonym(s):
Reactions associated
- RXN0-2601
- in-silico_annotation
- automated-name-match
- in-silico_annotation