Difference between revisions of "3-HYDROXY-L-KYNURENINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == * smiles: ** C([O-])(=O)C([N+])CC(=O)C1(=C(N)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1) |
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxy-L-kynurenine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 224.216 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-3-hydroxykynurenine |
| + | ** 3-hydroxy-kynurenine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-HYDROXY-KYNURENINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-10721]] | ||
== External links == | == External links == | ||
| + | * CAS : 606-14-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791998 49791998] |
| − | {{#set: smiles= | + | * HMDB : HMDB11631 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02794 C02794] |
| − | {{#set: molecular weight= | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58125 58125] |
| − | {{#set: consumed by= | + | * METABOLIGHTS : MTBLC58125 |
| − | {{#set: produced by= | + | {{#set: smiles=C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)}} |
| + | {{#set: common name=3-hydroxy-L-kynurenine}} | ||
| + | {{#set: inchi key=InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N}} | ||
| + | {{#set: molecular weight=224.216 }} | ||
| + | {{#set: common name=L-3-hydroxykynurenine|3-hydroxy-kynurenine}} | ||
| + | {{#set: consumed by=3-HYDROXY-KYNURENINASE-RXN}} | ||
| + | {{#set: produced by=KYNURENINE-3-MONOOXYGENASE-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-10721}} | ||
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite 3-HYDROXY-L-KYNURENINE
- smiles:
- C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)
- common name:
- 3-hydroxy-L-kynurenine
- inchi key:
- InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N
- molecular weight:
- 224.216
- Synonym(s):
- L-3-hydroxykynurenine
- 3-hydroxy-kynurenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 606-14-4
- PUBCHEM:
- HMDB : HMDB11631
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58125
"C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)" cannot be used as a page name in this wiki.
