Difference between revisions of "Tiso gene 16559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_2693 == * left end position: ** 5729 * transcription direction: ** POSITIVE * right end position: ** 9322 * centisome position: ** 30.83589...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] ==
+
== Gene Tiso_gene_2693 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 5729
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
** 9322
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 30.835892    
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
 
−
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
 
−
** 4α-methylfecosterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DIHYDLIPACETRANS-RXN]]
−
* [[RXN-4144]]
+
** [[pantograph]]-[[creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* [[PYRUVDEH-RXN]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-12508]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
* [[RXN-12583]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
* [[RXN0-1133]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN0-1134]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PYRUVDEHYD-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-7384]]
 +
* [[PWY-6886]]
 +
* [[PWY-5537]]
 +
* [[GLYCOLYSIS-TCA-GLYOX-BYPASS]]
 +
* [[PWY-5482]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5729}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=9322}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094]
+
{{#set: centisome position=30.835892   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=DIHYDLIPACETRANS-RXN|PYRUVDEH-RXN|RXN-12508|RXN-12583|RXN0-1133|RXN0-1134}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776]
+
{{#set: pathway associated=PYRUVDEHYD-PWY|PWY-7218|PWY-7384|PWY-6886|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-5482}}
−
* HMDB : HMDB06845
+
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}}
+
−
{{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}}
+
−
{{#set: molecular weight=412.698   }}
+
−
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}}
+
−
{{#set: produced by=RXN-4144}}
+

Revision as of 17:33, 10 January 2018

Gene Tiso_gene_2693

  • left end position:
    • 5729
  • transcription direction:
    • POSITIVE
  • right end position:
    • 9322
  • centisome position:
    • 30.835892
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16559&oldid=18408"