Difference between revisions of "Cis-delta7-3-oxo-cerotoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-499 RXN1G-499] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-lignoceroyl-[acyl-car...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-499 RXN1G-499] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
 
* common name:
 
* common name:
−
** 3-oxo-lignoceroyl-[acyl-carrier protein] synthase
+
** cholest-5-en-3-one
−
** 3-oxoacyl-synthase
+
* molecular weight:
−
* ec number:
+
** 384.644   
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Behenoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-lignoceroyl-ACPs]][c]
+
* [[RXN-12693]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a behenoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 coenzyme A[c] '''+''' 1 CO2[c] '''+''' 1 a 3-oxo-lignoceroyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-lignoceroyl-[acyl-carrier protein] synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
−
{{#set: common name=3-oxoacyl-synthase}}
+
* CHEBI:
−
{{#set: ec number=EC-2.3.1.41}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
−
{{#set: gene associated=Tiso_gene_5939|Tiso_gene_15991|Tiso_gene_19302|Tiso_gene_14485}}
+
* METABOLIGHTS : MTBLC63906
−
{{#set: in pathway=PWYG-321}}
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=cholest-5-en-3-one}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=384.644    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-12693}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Revision as of 16:22, 10 January 2018

Metabolite CPD-13684

  • smiles:
    • CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
  • common name:
    • cholest-5-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta7-3-oxo-cerotoyl-ACPs&oldid=12645"