|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCIT-CLEAV-RXN ISOCIT-CLEAV-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) |
| + | * inchi key: |
| + | ** InChIKey=OMYMRCXOJJZYKE-UHFFFAOYSA-N |
| * common name: | | * common name: |
− | ** isocitrate_lyase | + | ** 6-hydroxymelatonin |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/4.1.3.1 EC-4.1.3.1] | + | ** 248.281 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-11058]] |
− | ** 1 [[THREO-DS-ISO-CITRATE]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[SUC]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-11056]] |
− | ** 1 D-threo-isocitrate[c] '''<=>''' 1 glyoxylate[c] '''+''' 1 succinate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_14008]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969] | + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13245 13245] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1864 1864] |
− | * PIR:
| + | * HMDB : HMDB04081 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A41338 A41338]
| + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40713 I40713] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05643 C05643] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JA0155 JA0155]
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC6182 JC6182]
| + | ** [http://www.chemspider.com/Chemical-Structure.1794.html 1794] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26857 S26857]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26858 S26858]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2198 2198] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S39953 S39953]
| + | * METABOLIGHTS : MTBLC2198 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S52819 S52819]
| + | {{#set: smiles=CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2))}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S77654 S77654]
| + | {{#set: inchi key=InChIKey=OMYMRCXOJJZYKE-UHFFFAOYSA-N}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04115 T04115]
| + | {{#set: common name=6-hydroxymelatonin}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06353 T06353]
| + | {{#set: molecular weight=248.281 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07631 T07631]
| + | {{#set: consumed by=RXN-11058}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07632 T07632]
| + | {{#set: produced by=RXN-11056}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08046 T08046]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09774 T09774]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09779 T09779]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11209 T11209]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZBYI WZBYI]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCKI WZCKI]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCNIU WZCNIU]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCSI WZCSI]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZECIC WZECIC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZRPI WZRPI]
| + | |
− | * LIGAND-RXN: | + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00479 R00479] | + | |
− | * UNIPROT: | + | |
− | ** [http://www.uniprot.org/uniprot/P28467 P28467] | + | |
− | ** [http://www.uniprot.org/uniprot/P42449 P42449]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20699 P20699] | + | |
− | ** [http://www.uniprot.org/uniprot/O13439 O13439] | + | |
− | ** [http://www.uniprot.org/uniprot/P28299 P28299]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12031 Q12031]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46831 P46831] | + | |
− | ** [http://www.uniprot.org/uniprot/O24588 O24588]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49297 P49297]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45456 P45456]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45457 P45457]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39577 Q39577]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41084 Q41084]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43097 Q43097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28240 P28240]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20014 P20014]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17069 P17069]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15479 P15479]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9G6 P0A9G6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25248 P25248]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=isocitrate_lyase}}
| + | |
− | {{#set: ec number=EC-4.1.3.1}}
| + | |
− | {{#set: gene associated=Tiso_gene_14008}}
| + | |
− | {{#set: in pathway=P105-PWY|GLYOXYLATE-BYPASS|PWY-6969}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=esiliculosus}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |