Difference between revisions of "PWY-7185"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_6983 == * left end position: ** 8651 * transcription direction: ** NEGATIVE * right end position: ** 10929 * centisome position: ** 74.3596...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6983 == |
− | * | + | * left end position: |
− | ** | + | ** 8651 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 10929 |
− | * | + | * centisome position: |
− | ** | + | ** 74.359634 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[PYRUVDEH-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[athaliana]] |
− | * [[ | + | ** [[pantograph]]-[[synechocystis]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[RXN- | + | * [[RXN-12508]] |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-12583]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN0-1134]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PYRUVDEHYD-PWY]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5537]] | ||
+ | * [[GLYCOLYSIS-TCA-GLYOX-BYPASS]] | ||
+ | * [[PWY-5482]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=8651}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=10929}} | |
− | + | {{#set: centisome position=74.359634 }} | |
− | + | {{#set: reaction associated=PYRUVDEH-RXN|RXN-12508|RXN-12583|RXN0-1134}} | |
− | + | {{#set: pathway associated=PYRUVDEHYD-PWY|PWY-7218|PWY-7384|PWY-6886|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-5482}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:29, 18 March 2018
Gene Tiso_gene_6983
- left end position:
- 8651
- transcription direction:
- NEGATIVE
- right end position:
- 10929
- centisome position:
- 74.359634
- Synonym(s):
Reactions associated
- PYRUVDEH-RXN
- RXN-12508
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-12583
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-athaliana
- pantograph-esiliculosus
- in-silico_annotation
- RXN0-1134
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation