Difference between revisions of "RXN-12862"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17386 CPD-17386] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Gene == Gene Tiso_gene_2957 == * left end position: ** 16260 * transcription direction: ** POSITIVE * right end position: ** 17836 * centisome position: ** 90.706...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17386 CPD-17386] ==
+
== Gene Tiso_gene_2957 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 16260
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NVOWZIBKQIWTDG-ADUCOSNASA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosaheptaenoyl-CoA
+
** 17836
−
* molecular weight:
+
* centisome position:
−
** 1100.019    
+
** 90.70624    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-2,6,9,12,15,18,21-heptaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16135]]
+
* [[1.1.1.145-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-16134]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-12693]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12747]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12789]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN66-342]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN66-350]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN66-353]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY66-378]]
 +
* [[PWY-7299]]
 +
* [[PWY-6948]]
 +
* [[PWY-6946]]
 +
* [[PWY-6944]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=16260}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193705 72193705]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=17836}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76360 76360]
+
{{#set: centisome position=90.70624   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=1.1.1.145-RXN|RXN-12693|RXN-12747|RXN-12789|RXN66-342|RXN66-350|RXN66-353}}
−
{{#set: inchi key=InChIKey=NVOWZIBKQIWTDG-ADUCOSNASA-J}}
+
{{#set: pathway associated=PWY66-378|PWY-7299|PWY-6948|PWY-6946|PWY-6944}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosaheptaenoyl-CoA}}
+
−
{{#set: molecular weight=1100.019   }}
+
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-2,6,9,12,15,18,21-heptaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16135}}
+
−
{{#set: produced by=RXN-16134}}
+

Revision as of 18:43, 18 March 2018

Gene Tiso_gene_2957

  • left end position:
    • 16260
  • transcription direction:
    • POSITIVE
  • right end position:
    • 17836
  • centisome position:
    • 90.70624
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12862&oldid=26348"