Difference between revisions of "RXN-12693"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5393 == * Synonym(s): == Reactions associated == * FADSYN-RXN ** in-silico_annotation ***automated-name-match ** pantograph-esil...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * common name: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == |
+ | * smiles: | ||
+ | ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O | ||
+ | * common name: | ||
+ | ** glycerophosphoserine | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M | ||
+ | * molecular weight: | ||
+ | ** 258.144 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14136]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931] | ||
+ | * BIGG : g3ps | ||
+ | {{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}} | ||
+ | {{#set: common name=glycerophosphoserine}} | ||
+ | {{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}} | ||
+ | {{#set: molecular weight=258.144 }} | ||
+ | {{#set: consumed by=RXN-14136}} |
Revision as of 15:31, 21 March 2018
Contents
Metabolite CPD0-2030
- smiles:
- C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
- common name:
- glycerophosphoserine
- inchi key:
- InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
- molecular weight:
- 258.144
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.