Difference between revisions of "Tiso gene 2515"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * common...") |
(Created page with "Category:Gene == Gene Tiso_gene_2515 == * right end position: ** 3011 * transcription direction: ** POSITIVE * left end position: ** 11 * centisome position: ** 5.75524500...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2515 == |
− | * | + | * right end position: |
− | ** | + | ** 3011 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 11 |
− | * | + | * centisome position: |
− | ** | + | ** 5.755245000e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PYRUVDEH-RXN]] |
− | + | ** Source: [[orthology-athaliana]] | |
− | * [[RXN- | + | ** Source: [[orthology-synechocystis]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[RXN-12508]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12583]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-1134]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PYRUVDEHYD-PWY]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5537]] | ||
+ | * [[GLYCOLYSIS-TCA-GLYOX-BYPASS]] | ||
+ | * [[PWY-5482]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3011}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=11}} | |
− | + | {{#set: centisome position=5.755245000e-2}} | |
− | + | {{#set: reaction associated=PYRUVDEH-RXN|RXN-12508|RXN-12583|RXN0-1134}} | |
− | + | {{#set: pathway associated=PYRUVDEHYD-PWY|PWY-7218|PWY-7384|PWY-6886|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-5482}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Gene Tiso_gene_2515
- right end position:
- 3011
- transcription direction:
- POSITIVE
- left end position:
- 11
- centisome position:
- 5.755245000e-2
- Synonym(s):
Reactions associated
- Reaction: PYRUVDEH-RXN
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Reaction: RXN-12508
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-12583
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN0-1134
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation