Difference between revisions of "Tiso gene 1280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
(Created page with "Category:Gene == Gene Tiso_gene_1280 == * right end position: ** 16470 * transcription direction: ** POSITIVE * left end position: ** 8769 * centisome position: ** 35.6304...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
+
== Gene Tiso_gene_1280 ==
−
* smiles:
+
* right end position:
−
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
** 16470
−
* common name:
+
* transcription direction:
−
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
+
** 8769
−
* molecular weight:
+
* centisome position:
−
** 353.228    
+
** 35.63041    
 
* Synonym(s):
 
* Synonym(s):
−
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10058]]
+
* Reaction: [[3.2.2.23-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[4.2.99.18-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-2601]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=16470}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=8769}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
+
{{#set: centisome position=35.63041   }}
−
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
{{#set: reaction associated=3.2.2.23-RXN|4.2.99.18-RXN|RXN0-2601}}
−
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
+
−
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
+
−
{{#set: molecular weight=353.228   }}
+
−
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
+
−
{{#set: consumed by=RXN-10058}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_1280

  • right end position:
    • 16470
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8769
  • centisome position:
    • 35.63041
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1280&oldid=46639"