Difference between revisions of "ATP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] == * direction: ** REVERSIBLE * ec num...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATP ATP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATP ATP] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O-])[O-])([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9]
+
** ATP
 +
* inchi key:
 +
** InChIKey=ZKHQWZAMYRWXGA-KQYNXXCUSA-J
 +
* molecular weight:
 +
** 503.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylpyrophosphate
 +
** adenosine-triphosphate
 +
** adenosine-5'-triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[ARGININE--TRNA-LIGASE-RXN]]
−
** 2 [[ACETYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[ACETOACETYL-COA]][c]
+
* [[ATPPH]]
−
* With common name(s):
+
* [[RXN66-480]]
−
** 2 acetyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 acetoacetyl-CoA[c]
+
* [[RXN0-7248]]
−
 
+
* [[AGK]]
−
== Genes associated with this reaction  ==
+
* [[SPHINGANINE-KINASE-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
−
* [[Tiso_gene_17451]]
+
* [[RXN-7913]]
−
** [[pantograph]]-[[synechocystis]]
+
* [[RXN0-2023]]
−
** [[pantograph]]-[[esiliculosus]]
+
* [[DEPHOSPHOCOAKIN-RXN]]
−
* [[Tiso_gene_15327]]
+
* [[GMP-SYN-GLUT-RXN]]
−
** [[pantograph]]-[[athaliana]]
+
* [[RXN-15733]]
−
** [[pantograph]]-[[athaliana]]
+
* [[DGDPKIN-RXN]]
−
** [[pantograph]]-[[athaliana]]
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
−
** [[pantograph]]-[[athaliana]]
+
* [[6.3.5.7-RXN]]
−
** [[pantograph]]-[[esiliculosus]]
+
* [[3.6.3.1-RXN]]
−
** [[pantograph]]-[[creinhardtii]]
+
* [[DIHYDROFOLATESYNTH-RXN]]
−
* [[Tiso_gene_16181]]
+
* [[THIAMIN-DIPHOSPHATE-KINASE-RXN]]
−
** [[pantograph]]-[[athaliana]]
+
* [[RXN-12093]]
−
== Pathways  ==
+
* [[GMP-SYN-NH3-RXN]]
−
* [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY]
+
* [[ACETATE--COA-LIGASE-RXN]]
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
−
* [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177]
+
* [[RXN66-484]]
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[AUPT]]
−
* [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
−
** '''4''' reactions found over '''8''' reactions in the full pathway
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
−
* [[P163-PWY]], L-lysine fermentation to acetate and butanoate: [http://metacyc.org/META/NEW-IMAGE?object=P163-PWY P163-PWY]
+
* [[2.7.1.127-RXN]]
−
** '''1''' reactions found over '''10''' reactions in the full pathway
+
* [[PNKIN-RXN]]
−
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
+
* [[R223-RXN]]
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[R5PDP]]
−
* [[PWY-5676]], acetyl-CoA fermentation to butanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5676 PWY-5676]
+
* [[ARPT]]
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
* [[GUANYL-KIN-RXN]]
−
* [[PWY-6588]], pyruvate fermentation to acetone: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588]
+
* [[ATCMf]]
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
−
* [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779]
+
* [[GLUTKIN-RXN]]
−
** '''2''' reactions found over '''10''' reactions in the full pathway
+
* [[ATDGM]]
−
* [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778]
+
* [[ATAM]]
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
* [[BTUR2-RXN]]
−
* [[PWY1-3]], polyhydroxybutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1-3 PWY1-3]
+
* [[RXN-7163]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[6.1.1.24-RXN]]
−
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
+
* [[RXN66-521]]
−
** '''8''' reactions found over '''16''' reactions in the full pathway
+
* [[ATDGD]]
−
* [[PWY-6876]], isopropanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876]
+
* [[RXN66-555]]
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
−
* [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY]
+
* [[DNA-LIGASE-ATP-RXN]]
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[ATPASE-RXN]]
−
* [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
+
* [[RXN0-6541]]
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-1685]]
−
* [[PWY-5741]], ethylmalonyl-CoA pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741]
+
* [[DETHIOBIOTIN-SYN-RXN]]
−
** '''2''' reactions found over '''11''' reactions in the full pathway
+
* [[RNA-LIGASE-ATP-RXN]]
−
* [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[DGSNPT]]
−
* [[ACETOACETATE-DEG-PWY]], acetoacetate degradation (to acetyl CoA): [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DEG-PWY ACETOACETATE-DEG-PWY]
+
* [[FRUCTOKINASE-RXN]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[S-ADENMETSYN-RXN]]
−
* [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
+
* [[ADENYL-KIN-RXN]]
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[GLUTAMINESYN-RXN]]
−
* [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
+
* [[ATID]]
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PYRUVATE-CARBOXYLASE-RXN]]
−
* [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
+
* [[ATDTDm]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
−
* [[PWY66-368]], ketolysis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368]
+
* [[GLUTATHIONE-SYN-RXN]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN1G-4355]]
−
* [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
+
* [[ATP_3h_th]]
−
** '''5''' reactions found over '''17''' reactions in the full pathway
+
* [[RXN-9386]]
−
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
* [[ATP_3h_tm]]
−
** '''5''' reactions found over '''11''' reactions in the full pathway
+
* [[PEPCARBOXYKIN-RXN]]
−
* [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
+
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
−
** '''4''' reactions found over '''8''' reactions in the full pathway
+
* [[NDPKm]]
−
== Reconstruction information  ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
−
* [[orthology]]:
+
* [[RXN-12002]]
−
** [[pantograph]]:
+
* [[ATCDm]]
−
*** [[creinhardtii]]
+
* [[ACYLCOASYN-RXN]]
−
*** [[synechocystis]]
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
−
*** [[athaliana]]
+
* [[ATDUD]]
−
*** [[esiliculosus]]
+
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[6.3.4.16-RXN]]
 +
* [[6.3.4.10-RXN]]
 +
* [[RXN-15005]]
 +
* [[6.3.5.6-RXN]]
 +
* [[RXN-8626]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[RXN0-1141]]
 +
* [[2.7.1.139-RXN]]
 +
* [[PANTEPADENYLYLTRAN-RXN]]
 +
* [[LNLNCACOAL]]
 +
* [[RXN1F-20]]
 +
* [[ADENOSINETRIPHOSPHATASE-RXN]]
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-17917]]
 +
* [[PYRAMKIN-RXN]]
 +
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 +
* [[RXN-2001]]
 +
* [[ATDCDm]]
 +
* [[PCr]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[CHOLINE-KINASE-RXN]]
 +
* [[RXN-12978]]
 +
* [[SERINE--TRNA-LIGASE-RXN]]
 +
* [[DADPKIN-RXN]]
 +
* [[RXN-9623]]
 +
* [[NICONUCADENYLYLTRAN-RXN]]
 +
* [[NDPK]]
 +
* [[FADSYN-RXN]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-14391]]
 +
* [[RME256]]
 +
* [[RME255]]
 +
* [[ATCY]]
 +
* [[ATCD]]
 +
* [[RXN0-7239]]
 +
* [[ATDAM]]
 +
* [[PYRIDOXKIN-RXN]]
 +
* [[RXN-11109]]
 +
* [[BIOTINLIG-RXN]]
 +
* [[RXN3DJ-11417]]
 +
* [[RXN0-742]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[3.6.4.9-RXN]]
 +
* [[KETOHEXOKINASE-RXN]]
 +
* [[RXN-9644]]
 +
* [[RXN-8654]]
 +
* [[DCDPKIN-RXN]]
 +
* [[GSADENYLATION-RXN]]
 +
* [[RXN-17127]]
 +
* [[SAICARSYN-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[RXN-12720]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[ADENYLATECYC-RXN]]
 +
* [[TETRAACYLDISACC4KIN-RXN]]
 +
* [[3.6.4.1-RXN]]
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 +
* [[XYLULOKIN-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[2.7.1.68-RXN]]
 +
* [[AGPT]]
 +
* [[RXN-16418]]
 +
* [[PROTEIN-KINASE-RXN]]
 +
* [[VALINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-1126]]
 +
* [[PEPSYNTH-RXN]]
 +
* [[RXN0-1401]]
 +
* [[DTDPKIN-RXN]]
 +
* [[RXN-10919]]
 +
* [[GLUCURONOKINASE-RXN]]
 +
* [[RXN-16165]]
 +
* [[HOMOSERKIN-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[FA160COAabcp]]
 +
* [[UDPGtni]]
 +
* [[PYRIMSYN3-RXN]]
 +
* [[NUCLEOSIDE-PHOSPHATE-KINASE-RXN]]
 +
* [[THMPPPT]]
 +
* [[ATCM]]
 +
* [[3.6.3.50-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[CDPKIN-RXN]]
 +
* [[6.3.2.25-RXN]]
 +
* [[THIAZOLSYN3-RXN]]
 +
* [[RME144]]
 +
* [[TRANS-RXN0-623]]
 +
* [[ATUDm]]
 +
* [[3.6.4.6-RXN]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[MANNKIN-RXN]]
 +
* [[RXN0-5055]]
 +
* [[GLY3KIN-RXN]]
 +
* [[UDPKIN-RXN]]
 +
* [[ATDCD]]
 +
* [[ATDTD]]
 +
* [[ATDCMf]]
 +
* [[ATDCM]]
 +
* [[DCYTPT]]
 +
* [[PANTOTHENATE-KIN-RXN]]
 +
* [[RXN66-477]]
 +
* [[DUDPKIN-RXN]]
 +
* [[RXN66-474]]
 +
* [[RXN-12184]]
 +
* [[2.7.1.140-RXN]]
 +
* [[RXN-13290]]
 +
* [[AIRS-RXN]]
 +
* [[TYROSINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-16393]]
 +
* [[RXN0-5116]]
 +
* [[RXN-16389]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ATAMf]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[AGPTf]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[DTMPKI-RXN]]
 +
* [[ATAMm]]
 +
* [[M5TRK]]
 +
* [[TMDPT]]
 +
* [[RXN-14196]]
 +
* [[ATUD]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[RIBOKIN-RXN]]
 +
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[2.7.1.133-RXN]]
 +
* [[ATDUDm]]
 +
* [[BIOTIN-CARBOXYL-RXN]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[GDPPYPHOSKIN-RXN]]
 +
* [[CYTIKIN-RXN]]
 +
* [[RME294]]
 +
* [[RXN66-469]]
 +
* [[RXN-7904]]
 +
* [[R344-RXN]]
 +
* [[RXN-14325]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[FTHFL]]
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
* [[2.7.1.149-RXN]]
 +
* [[RXN-17925]]
 +
* [[RXN0-7192]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[NAD-KIN-RXN]]
 +
* [[RXN-16380]]
 +
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[GDPKIN-RXN]]
 +
* [[RXN-9673]]
 +
* [[ADCPT]]
 +
* [[RXN-11832]]
 +
* [[AASP]]
 +
* [[RXN-13202]]
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 +
* [[6.3.4.11-RXN]]
 +
* [[ATIDm]]
 +
* [[RXN-13614]]
 +
* [[2.7.10.1-RXN]]
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[ADEC]]
 +
* [[RXN0-7238]]
 +
* [[2.7.1.148-RXN]]
 +
* [[2.7.13.3-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-10695]]
 +
* [[RXN0-5098]]
 +
* [[ATGD]]
 +
* [[RXN-16909]]
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[RXN-4303]]
 +
* [[6.3.4.9-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[RXN0-2161]]
 +
* [[DAD2PT]]
 +
* [[GLCURK]]
 +
* [[LNLCCOAL]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[GMKALT-RXN]]
 +
* [[3.6.4.4-RXN]]
 +
* [[PE1819Z1819Zt]]
 +
* [[RXN0-4261]]
 +
* [[APYRASE-RXN]]
 +
* [[2.7.1.134-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[RXN-8443]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[2.7.9.3-RXN]]
 +
* [[UMPKf]]
 +
* [[RXN66-483]]
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 +
* [[FACOAL18111Z]]
 +
* [[CARNOSINE-SYNTHASE-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[COBALADENOSYLTRANS-RXN]]
 +
* [[RXN0-2921]]
 +
* [[FGAMSYN-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[ATP_3h_th]]
 +
* [[ATP_3h_tm]]
 +
== Reaction(s) of unknown directionality ==
 +
* [[2.7.11.2-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[RXN-6341]]
 +
* [[5.99.1.3-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[RXN-14906]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[RPDPK]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[3.6.3.8-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TRANS-RXN-249]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[RXN-16415]]
 +
* [[RXN-14120]]
 +
* [[CARBAMATE-KINASE-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[RXN-16317]]
 +
* [[RXN-11135]]
 +
* [[RXN-10038]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[2.7.11.20-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[D-RIBULOKIN-RXN]]
 +
* [[PANTETHEINE-KINASE-RXN]]
 +
* [[2.7.11.18-RXN]]
 +
* [[PROLINE-MULTI]]
 +
* [[ATPSYN-RXN]]
 +
* [[RXN-14223]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[TCX8]]
 +
* [[RIBULOKIN-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 +
* [[RXN-14228]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[2.7.11.22-RXN]]
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 56-65-5
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21036 21036]
+
* BIGG : atp
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00238 R00238]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461108 5461108]
−
* UNIPROT:
+
* HMDB : HMDB00538
−
** [http://www.uniprot.org/uniprot/Q8CAY6 Q8CAY6]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P41338 P41338]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00002 C00002]
−
** [http://www.uniprot.org/uniprot/P45362 P45362]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/Q9BWD1 Q9BWD1]
+
** [http://www.chemspider.com/Chemical-Structure.4574455.html 4574455]
−
** [http://www.uniprot.org/uniprot/P45359 P45359]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P24752 P24752]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30616 30616]
−
** [http://www.uniprot.org/uniprot/Q12598 Q12598]
+
* METABOLIGHTS : MTBLC30616
−
** [http://www.uniprot.org/uniprot/P45369 P45369]
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O-])[O-])([O-])=O}}
−
** [http://www.uniprot.org/uniprot/P46707 P46707]
+
{{#set: common name=ATP}}
−
** [http://www.uniprot.org/uniprot/P73825 P73825]
+
{{#set: inchi key=InChIKey=ZKHQWZAMYRWXGA-KQYNXXCUSA-J}}
−
** [http://www.uniprot.org/uniprot/Q43637 Q43637]
+
{{#set: molecular weight=503.152    }}
−
** [http://www.uniprot.org/uniprot/Q9UQW6 Q9UQW6]
+
{{#set: common name=adenylpyrophosphate|adenosine-triphosphate|adenosine-5'-triphosphate}}
−
** [http://www.uniprot.org/uniprot/Q9Z3Y4 Q9Z3Y4]
+
{{#set: consumed by=ARGININE--TRNA-LIGASE-RXN|ATPPH|RXN66-480|RXN0-7248|AGK|SPHINGANINE-KINASE-RXN|HISTIDINE--TRNA-LIGASE-RXN|RXN-7913|RXN0-2023|DEPHOSPHOCOAKIN-RXN|GMP-SYN-GLUT-RXN|RXN-15733|DGDPKIN-RXN|THIAMIN-PYROPHOSPHOKINASE-RXN|6.3.5.7-RXN|3.6.3.1-RXN|DIHYDROFOLATESYNTH-RXN|THIAMIN-DIPHOSPHATE-KINASE-RXN|RXN-12093|GMP-SYN-NH3-RXN|ACETATE--COA-LIGASE-RXN|DIPHTINE--AMMONIA-LIGASE-RXN|RXN66-484|AUPT|LEUCINE--TRNA-LIGASE-RXN|ASPARTATE--TRNA-LIGASE-RXN|2.7.1.127-RXN|PNKIN-RXN|R223-RXN|R5PDP|ARPT|GUANYL-KIN-RXN|ATCMf|TRYPTOPHAN--TRNA-LIGASE-RXN|GLUTKIN-RXN|ATDGM|ATAM|BTUR2-RXN|RXN-7163|6.1.1.24-RXN|RXN66-521|ATDGD|RXN66-555|RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.|DNA-LIGASE-ATP-RXN|ATPASE-RXN|RXN0-6541|RXN-1685|DETHIOBIOTIN-SYN-RXN|RNA-LIGASE-ATP-RXN|UBIQUITIN--PROTEIN-LIGASE-RXN|DGSNPT|FRUCTOKINASE-RXN|S-ADENMETSYN-RXN|ADENYL-KIN-RXN|GLUTAMINESYN-RXN|ATID|PYRUVATE-CARBOXYLASE-RXN|ATDTDm|1-PHOSPHATIDYLINOSITOL-KINASE-RXN|GLUTATHIONE-SYN-RXN|RXN1G-4355|ATP_3h_th|RXN-9386|ATP_3h_tm|PEPCARBOXYKIN-RXN|FOLYLPOLYGLUTAMATESYNTH-RXN|NDPKm|4-COUMARATE--COA-LIGASE-RXN|RXN-12002|ATCDm|ACYLCOASYN-RXN|ASPARAGINE--TRNA-LIGASE-RXN|ATDUD|ACETYL-COA-CARBOXYLTRANSFER-RXN|6.3.4.16-RXN|6.3.4.10-RXN|RXN-15005|6.3.5.6-RXN|RXN-8626|FORMATETHFLIG-RXN|RXN0-1141|2.7.1.139-RXN|PANTEPADENYLYLTRAN-RXN|LNLNCACOAL|RXN1F-20|ADENOSINETRIPHOSPHATASE-RXN|THREONINE--TRNA-LIGASE-RXN|RXN-17917|PYRAMKIN-RXN|H2PTERIDINEPYROPHOSPHOKIN-RXN|RXN-2001|ATDCDm|PCr|GLYRIBONUCSYN-RXN|CTPSYN-RXN|DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN|CHOLINE-KINASE-RXN|RXN-12978|SERINE--TRNA-LIGASE-RXN|DADPKIN-RXN|RXN-9623|NICONUCADENYLYLTRAN-RXN|NDPK|FADSYN-RXN|ALANINE--TRNA-LIGASE-RXN|RXN-14391|RME256|RME255|ATCY|ATCD|RXN0-7239|ATDAM|PYRIDOXKIN-RXN|RXN-11109|BIOTINLIG-RXN|RXN3DJ-11417|RXN0-742|URIDINEKIN-RXN|CARBPSYN-RXN|3.6.4.9-RXN|KETOHEXOKINASE-RXN|RXN-9644|RXN-8654|DCDPKIN-RXN|GSADENYLATION-RXN|RXN-17127|SAICARSYN-RXN|GTPPYPHOSKIN-RXN|RXN-12720|GLUTCYSLIG-RXN|ADENYLATECYC-RXN|TETRAACYLDISACC4KIN-RXN|3.6.4.1-RXN|PROLINE--TRNA-LIGASE-RXN|XYLULOKIN-RXN|5-OXOPROLINASE-ATP-HYDROLYSING-RXN|2.7.1.68-RXN|AGPT|RXN-16418|PROTEIN-KINASE-RXN|VALINE--TRNA-LIGASE-RXN|RXN-1126|PEPSYNTH-RXN|RXN0-1401|DTDPKIN-RXN|RXN-10919|GLUCURONOKINASE-RXN|RXN-16165|HOMOSERKIN-RXN|FORMYLTHFGLUSYNTH-RXN|FA160COAabcp|UDPGtni|PYRIMSYN3-RXN|NUCLEOSIDE-PHOSPHATE-KINASE-RXN|THMPPPT|ATCM|3.6.3.50-RXN|GLUTAMINE--TRNA-LIGASE-RXN|CDPKIN-RXN|6.3.2.25-RXN|THIAZOLSYN3-RXN|RME144|TRANS-RXN0-623|ATUDm|3.6.4.6-RXN|METHYLCROTONYL-COA-CARBOXYLASE-RXN|MANNKIN-RXN|RXN0-5055|GLY3KIN-RXN|UDPKIN-RXN|ATDCD|ATDTD|ATDCMf|ATDCM|DCYTPT|PANTOTHENATE-KIN-RXN|RXN66-477|DUDPKIN-RXN|RXN66-474|RXN-12184|2.7.1.140-RXN|RXN-13290|AIRS-RXN|TYROSINE--TRNA-LIGASE-RXN|RXN-16393|RXN0-5116|RXN-16389|DIACYLGLYKIN-RXN|ASNSYNB-RXN|ATAMf|ARGSUCCINSYN-RXN|AGPTf|ADENOSINE-KINASE-RXN|DTMPKI-RXN|ATAMm|M5TRK|TMDPT|RXN-14196|ATUD|DEOXYADENYLATE-KINASE-RXN|6.2.1.34-RXN|RIBOKIN-RXN|ETHANOLAMINE-KINASE-RXN|2.7.1.133-RXN|ATDUDm|BIOTIN-CARBOXYL-RXN|RXN-16401|RXN-16402|GDPPYPHOSKIN-RXN|CYTIKIN-RXN|RME294|RXN66-469|RXN-7904|R344-RXN|RXN-14325|LINOLENOYL-RXN|FTHFL|PANTOATE-BETA-ALANINE-LIG-RXN|2.7.1.149-RXN|RXN-17925|RXN0-7192|RIBOFLAVINKIN-RXN|NAD-KIN-RXN|RXN-16380|RNA-3-PHOSPHATE-CYCLASE-RXN|GLYCERONE-KINASE-RXN|GDPKIN-RXN|RXN-9673|ADCPT|RXN-11832|AASP|RXN-13202|CYSTEINE--TRNA-LIGASE-RXN|6.3.4.11-RXN|ATIDm|RXN-13614|2.7.10.1-RXN|GLYCINE--TRNA-LIGASE-RXN|PHENYLALANINE--TRNA-LIGASE-RXN|ADEC|RXN0-7238|2.7.1.148-RXN|2.7.13.3-RXN|RXN-10|RXN-10695|RXN0-5098|ATGD|RXN-16909|ISOLEUCINE--TRNA-LIGASE-RXN|6-PHOSPHOFRUCTO-2-KINASE-RXN|RXN-4303|6.3.4.9-RXN|ASNSYNA-RXN|RXN0-2161|DAD2PT|GLCURK|LNLCCOAL|NUCLEOSIDE-DIP-KIN-RXN|GMKALT-RXN|3.6.4.4-RXN|PE1819Z1819Zt|RXN0-4261|APYRASE-RXN|2.7.1.134-RXN|GLURS-RXN|RXN-8443|METHIONINE--TRNA-LIGASE-RXN|6PFRUCTPHOS-RXN|2.7.9.3-RXN|UMPKf|RXN66-483|LYSINE--TRNA-LIGASE-RXN|FACOAL18111Z|CARNOSINE-SYNTHASE-RXN|GLUCOKIN-RXN|COBALADENOSYLTRANS-RXN|RXN0-2921|FGAMSYN-RXN}}
−
** [http://www.uniprot.org/uniprot/P77852 P77852]
+
{{#set: produced by=ATP_3h_th|ATP_3h_tm}}
−
** [http://www.uniprot.org/uniprot/Q9XD81 Q9XD81]
+
{{#set: reversible reaction associated=2.7.11.2-RXN|GALACTOKIN-RXN|HEXOKINASE-RXN|RXN-6341|5.99.1.3-RXN|PRPPSYN-RXN|RXN-14906|SHIKIMATE-KINASE-RXN|ATPPHOSPHORIBOSYLTRANS-RXN|ASPARTATEKIN-RXN|RPDPK|PROPIONYL-COA-CARBOXY-RXN|3.6.3.8-RXN|PHOSPHORIBULOKINASE-RXN|ADENYLYLSULFKIN-RXN|GLYCEROL-KIN-RXN|ACETYLGLUTKIN-RXN|SULFATE-ADENYLYLTRANS-RXN|TRANS-RXN-249|PEPDEPHOS-RXN|RXN-16415|RXN-14120|CARBAMATE-KINASE-RXN|2.7.12.2-RXN|RXN-16317|RXN-11135|RXN-10038|MEVALONATE-KINASE-RXN|2.7.11.20-RXN|2.7.12.1-RXN|2.7.11.24-RXN|D-RIBULOKIN-RXN|PANTETHEINE-KINASE-RXN|2.7.11.18-RXN|PROLINE-MULTI|ATPSYN-RXN|RXN-14223|SUCCCOASYN-RXN|TCX8|RIBULOKIN-RXN|TAU-PROTEIN-KINASE-RXN|POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN|RXN-14228|PHOSGLYPHOS-RXN|2.7.11.22-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9ZGI9 Q9ZGI9]
+
−
** [http://www.uniprot.org/uniprot/Q9L8E0 Q9L8E0]
+
−
** [http://www.uniprot.org/uniprot/P14611 P14611]
+
−
** [http://www.uniprot.org/uniprot/P07097 P07097]
+
−
** [http://www.uniprot.org/uniprot/P17764 P17764]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-2.3.1.9}}
+
−
{{#set: gene associated=Tiso_gene_17451|Tiso_gene_15327|Tiso_gene_16181}}
+
−
{{#set: in pathway=P162-PWY|PWY-5177|PWY-6583|P163-PWY|PWY-6883|PWY-5676|PWY-6588|PWY-7779|PWY-7778|PWY1-3|PWY-5789|PWY-6876|CENTFERM-PWY|PWY-7391|PWY-5741|PWY-6174|ACETOACETATE-DEG-PWY|PWY66-367|PWY-7216|PWY-922|PWY66-368|PWY-7401|PWY-6863|PWY-7524}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii|synechocystis|athaliana|esiliculosus}}
+

Latest revision as of 21:18, 21 March 2018

Metabolite ATP

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O-])[O-])([O-])=O
  • common name:
    • ATP
  • inchi key:
    • InChIKey=ZKHQWZAMYRWXGA-KQYNXXCUSA-J
  • molecular weight:
    • 503.152
  • Synonym(s):
    • adenylpyrophosphate
    • adenosine-triphosphate
    • adenosine-5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 56-65-5
  • BIGG : atp
  • PUBCHEM:
  • HMDB : HMDB00538
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • METABOLIGHTS : MTBLC30616
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O-])[O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATP&oldid=47571"