Browse wiki
| CPD-18773 |
| Common name | (R)-demethyl-4-deoxygadusol + , (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one + |
|---|---|
| Consumed by | RXN-17366 + |
| Inchi key | InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N + |
| Molecular weight | 174.153 + |
| Produced by | RXN-17372 + |
| Reversible reaction associated | RXN-17895 + |
| Smiles | C(O)C1(O)(CC(=O)C(O)=C(O)C1) + |
| Categories | Metabolite |
| Modification date "Modification date" is a predefined property that corresponds to the date of the last modification of a subject and is provided by Semantic MediaWiki.
|
15:27:00, 9 January 2019 + |
| hide properties that link here |
| No properties link to this page. |
