Difference between revisions of "CHC T00004399001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-448 CPD-448] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene CHC_T00004399001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-15556 ** Source: orthology-galdieria.sulphuraria * Reaction:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00004399001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RXN-15556]] | |
| − | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
| − | * [[ | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
| − | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
| + | == Pathways associated == | ||
| + | * [[PWY-7511]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-7511}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 16:10, 23 May 2018
Gene CHC_T00004399001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: orthology-galdieria.sulphuraria
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: orthology-galdieria.sulphuraria
