Difference between revisions of "CPD-18773"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6792 PWY-6792] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) |
| + | * molecular weight: | ||
| + | ** 174.153 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-demethyl-4-deoxygadusol |
* Synonym(s): | * Synonym(s): | ||
| + | ** (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-17366]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-17372]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-17895]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}} |
| − | {{#set: common name= | + | {{#set: molecular weight=174.153 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N}} |
| − | {{#set: reaction | + | {{#set: common name=(R)-demethyl-4-deoxygadusol}} |
| + | {{#set: common name=(5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}} | ||
| + | {{#set: consumed by=RXN-17366}} | ||
| + | {{#set: produced by=RXN-17372}} | ||
| + | {{#set: reversible reaction associated=RXN-17895}} | ||
Latest revision as of 16:27, 9 January 2019
Contents
Metabolite CPD-18773
- smiles:
- C(O)C1(O)(CC(=O)C(O)=C(O)C1)
- molecular weight:
- 174.153
- inchi key:
- InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N
- common name:
- (R)-demethyl-4-deoxygadusol
- Synonym(s):
- (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
