Difference between revisions of "PWY-6383"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (S)-demethy...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* common name: | * common name: | ||
− | ** ( | + | ** TCA cycle III (animals) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tricarboxylic acid cycle |
+ | ** citric acid cycle | ||
+ | ** Szent-Gyorgyi-Krebs cycle | ||
+ | ** Krebs cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''10''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN0-1147]] |
− | + | ** [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | |
− | * [ | + | ** [[ISOCITRATE-DEHYDROGENASE-NAD+-RXN]] |
+ | ** [[MALATE-DEH-RXN]] | ||
+ | ** [[ACONITATEDEHYDR-RXN]] | ||
+ | ** [[ACONITATEHYDR-RXN]] | ||
+ | ** [[2OXOGLUTDECARB-RXN]] | ||
+ | ** [[CITSYN-RXN]] | ||
+ | ** [[SUCCCOASYN-RXN]] | ||
+ | ** [[FUMHYDR-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=SUCCINATE--COA-LIGASE-GDP-FORMING-RXN SUCCINATE--COA-LIGASE-GDP-FORMING-RXN] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: taxonomic range=TAX-33208}} |
− | {{#set: common name=( | + | {{#set: common name=TCA cycle III (animals)}} |
− | + | {{#set: common name=tricarboxylic acid cycle|citric acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}} | |
− | + | {{#set: reaction found=10}} | |
− | {{#set: common name= | + | {{#set: reaction not found=1}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:29, 18 January 2018
Pathway PWY66-398
- taxonomic range:
- common name:
- TCA cycle III (animals)
- Synonym(s):
- tricarboxylic acid cycle
- citric acid cycle
- Szent-Gyorgyi-Krebs cycle
- Krebs cycle
Reaction(s) found
- 10 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found