Difference between revisions of "PWY-5690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N
+
 
* common name:
 
* common name:
−
** menaquinol-12
+
** TCA cycle II (plants and fungi)
−
* molecular weight:
+
* taxonomic range:
−
** 991.617   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* Synonym(s):
 
* Synonym(s):
−
** MKH2-12
+
** TCA cycle -- aerobic respiration
 +
** tricarboxylic acid cycle
 +
** citric acid cycle
 +
** Szent-Gyorgyi-Krebs cycle
 +
** Krebs cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-9363]]
+
* [[2OXOGLUTARATEDEH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[CHC_T00008441001]]
 +
*** [[CHC_T00008312001]]
 +
*** [[CHC_T00008441001_1]]
 +
*** [[CHC_T00010287001_1]]
 +
*** [[CHC_T00008312001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ACONITATEDEHYDR-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009087001_1]]
 +
*** [[CHC_T00008781001_1]]
 +
*** [[CHC_T00008781001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009087001_1]]
 +
*** [[CHC_T00008781001]]
 +
*** [[CHC_T00008781001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[CITSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00007817001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008951001_1]]
 +
*** [[CHC_T00008951001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ISOCITRATE-DEHYDROGENASE-NAD+-RXN]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00008852001_1]]
 +
*** [[CHC_T00008852001]]
 +
*** [[CHC_T00009162001_1]]
 +
*** [[CHC_T00009293001]]
 +
*** [[CHC_T00009293001_1]]
 +
*** [[CHC_T00009162001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
* [[MALATE-DEH-RXN]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00009292001_1]]
 +
*** [[CHC_T00008733001_1]]
 +
*** [[CHC_T00008600001_1]]
 +
*** [[CHC_T00008733001]]
 +
*** [[CHC_T00009350001_1]]
 +
*** [[CHC_T00009173001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14971]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00006990001_1]]
 +
*** [[CHC_T00008943001]]
 +
*** [[CHC_T00001817001_1]]
 +
*** [[CHC_T00008943001_1]]
 +
*** [[CHC_T00007584001_1]]
 +
*** [[CHC_T00007286001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009212001_1]]
 +
*** [[CHC_T00008602001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=TCA cycle II (plants and fungi)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479280 45479280]
+
{{#set: taxonomic range=TAX-4751}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84550 84550]
+
{{#set: common name=TCA cycle -- aerobic respiration|tricarboxylic acid cycle|citric acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}}
+
{{#set: reaction found=9}}
−
{{#set: inchi key=InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N}}
+
{{#set: total reaction=9}}
−
{{#set: common name=menaquinol-12}}
+
{{#set: completion rate=100.0}}
−
{{#set: molecular weight=991.617    }}
+
−
{{#set: common name=MKH2-12}}
+
−
{{#set: produced by=RXN-9363}}
+

Latest revision as of 15:38, 9 January 2019

Pathway PWY-5690

  • common name:
    • TCA cycle II (plants and fungi)
  • taxonomic range:
  • Synonym(s):
    • TCA cycle -- aerobic respiration
    • tricarboxylic acid cycle
    • citric acid cycle
    • Szent-Gyorgyi-Krebs cycle
    • Krebs cycle

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5690&oldid=20579"