Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydrogenase-lipoyl Oxo-glutarate-dehydrogenase-lipoyl] == * common name: ** a [...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydrogenase-lipoyl Oxo-glutarate-dehydrogenase-lipoyl] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an enzyme N6-(lipoyl)lysine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2OXOGLUTDECARB-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14959]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-7716]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine}} | |
| − | + | {{#set: common name=an enzyme N6-(lipoyl)lysine}} | |
| − | {{#set: | + | {{#set: consumed by=2OXOGLUTDECARB-RXN}} |
| − | + | {{#set: produced by=RXN-14959}} | |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-7716}} |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:56, 23 May 2018
Contents
Metabolite Oxo-glutarate-dehydrogenase-lipoyl
- common name:
- a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine
- Synonym(s):
- an enzyme N6-(lipoyl)lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine" cannot be used as a page name in this wiki.
