Difference between revisions of "LEU-DEG2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N
+
 
* common name:
 
* common name:
** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol
+
** L-leucine degradation I
* molecular weight:
+
* taxonomic range:
** 428.697   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-311]]
+
'''3''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
* [[RXN66-310]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00010287001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00003864001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004158001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLCROTONYL-COA-CARBOXYLASE-RXN METHYLCROTONYL-COA-CARBOXYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLGLUTACONYL-COA-HYDRATASE-RXN METHYLGLUTACONYL-COA-HYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2301 RXN0-2301]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=L-leucine degradation I}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298936 22298936]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87289 87289]
+
{{#set: reaction found=3}}
* HMDB : HMDB12170
+
{{#set: total reaction=6}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: completion rate=50.0}}
{{#set: inchi key=InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N}}
+
{{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: molecular weight=428.697    }}
+
{{#set: consumed by=RXN66-311}}
+
{{#set: produced by=RXN66-310}}
+

Latest revision as of 16:09, 9 January 2019

Pathway LEU-DEG2-PWY

  • common name:
    • L-leucine degradation I
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links