Difference between revisions of "CPD-17641"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] == * smiles: ** C(=O)([O-])C(C1(=CC=C(O)C(O)=C1))O * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00009159001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009159001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | == | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 12:02, 18 January 2018
Gene CHC_T00009159001_1
- Synonym(s):