Difference between revisions of "CPD-18491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** cyclic-2,3-O-oxalyl-L-threonate
+
** mevalonate pathway I
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-cyclic oxalyl theronolactone
+
** isoprenoid pathway
 +
** MVA pathway
 +
** isopentenyl diphosphate biosynthesis
 +
** dimethylallyl diphosphate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12872]]
+
'''7''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.34-RXN]]
−
* [[RXN-12869]]
+
** 4 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-03_000570]]
 +
*** [[Ec-03_000580]]
 +
*** [[Ec-08_002990]]
 +
*** [[Ec-27_005710]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
*** [[Ec-24_000870]]
 +
*** [[Ec-22_002850]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_001440]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_002030]]
 +
*** [[Ec-21_004360]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-11_001030]]
 +
*** [[Ec-18_002690]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-26_004370]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-25_002910]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-922 PWY-922]
−
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+
{{#set: taxonomic range=TAX-33208}}
−
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: molecular weight=189.101    }}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: consumed by=RXN-12872}}
+
{{#set: common name=mevalonate pathway I}}
−
{{#set: produced by=RXN-12869}}
+
{{#set: common name=isoprenoid pathway|MVA pathway|isopentenyl diphosphate biosynthesis|dimethylallyl diphosphate biosynthesis}}
 +
{{#set: reaction found=7}}
 +
{{#set: total reaction=7}}
 +
{{#set: completion rate=100.0}}

Revision as of 13:33, 21 March 2018

Pathway PWY-922

  • taxonomic range:
  • common name:
    • mevalonate pathway I
  • Synonym(s):
    • isoprenoid pathway
    • MVA pathway
    • isopentenyl diphosphate biosynthesis
    • dimethylallyl diphosphate biosynthesis

Reaction(s) found

7 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18491&oldid=19693"