Difference between revisions of "CPD-18491"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** mevalonate pathway I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** isoprenoid pathway |
+ | ** MVA pathway | ||
+ | ** isopentenyl diphosphate biosynthesis | ||
+ | ** dimethylallyl diphosphate biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''7''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[1.1.1.34-RXN]] | |
− | * [[RXN- | + | ** 4 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-03_000570]] |
+ | *** [[Ec-03_000580]] | ||
+ | *** [[Ec-08_002990]] | ||
+ | *** [[Ec-27_005710]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-26_003940]] | ||
+ | *** [[Ec-24_000870]] | ||
+ | *** [[Ec-22_002850]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-21_001440]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-19_002030]] | ||
+ | *** [[Ec-21_004360]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[IPPISOM-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-11_001030]] | ||
+ | *** [[Ec-18_002690]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[MEVALONATE-KINASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-26_004370]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-25_002910]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-922 PWY-922] |
− | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-33208}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-4751}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: common name= | + | {{#set: taxonomic range=TAX-33090}} |
− | {{#set: | + | {{#set: common name=mevalonate pathway I}} |
− | {{#set: | + | {{#set: common name=isoprenoid pathway|MVA pathway|isopentenyl diphosphate biosynthesis|dimethylallyl diphosphate biosynthesis}} |
+ | {{#set: reaction found=7}} | ||
+ | {{#set: total reaction=7}} | ||
+ | {{#set: completion rate=100.0}} |
Revision as of 14:33, 21 March 2018
Pathway PWY-922
- taxonomic range:
- common name:
- mevalonate pathway I
- Synonym(s):
- isoprenoid pathway
- MVA pathway
- isopentenyl diphosphate biosynthesis
- dimethylallyl diphosphate biosynthesis
Reaction(s) found
7 reactions found over 7 reactions in the full pathway
- 1.1.1.34-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- IPPISOM-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- MEVALONATE-KINASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PHOSPHOMEVALONATE-KINASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: