Difference between revisions of "PWY-5994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] ==
* smiles:
+
* taxonomic range:
** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
* inchi key:
+
** InChIKey=DAEAPNUQQAICNR-RRKCRQDMSA-K
+
 
* common name:
 
* common name:
** dADP
+
** palmitate biosynthesis I (animals and fungi)
* molecular weight:
+
** 408.18   
+
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxyadenosine-5'-diphosphate
+
** palmitic acid biosynthesis
** deoxyadenosine-diphosphate
+
** de novo lipogenesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[DADPKIN-RXN]]
+
'''31''' reactions found over '''31''' reactions in the full pathway
* [[NDPKm]]
+
* [[3.1.2.21-RXN]]
* [[RXN-14215]]
+
** 0 associated gene:
* [[NDPK]]
+
** 1 reconstruction source(s) associated:
== Reaction(s) known to produce the compound ==
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
* [[DEOXYADENYLATE-KINASE-RXN]]
+
* [[4.2.1.58-RXN]]
* [[ADPREDUCT-RXN]]
+
** 6 associated gene(s):
* [[ATDAM]]
+
*** [[Tiso_gene_13394]]
* [[DATUP]]
+
*** [[Tiso_gene_6884]]
* [[DATCY]]
+
*** [[Tiso_gene_136]]
* [[RXN-14214]]
+
*** [[Tiso_gene_10876]]
* [[RXN0-747]]
+
*** [[Tiso_gene_500]]
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_135]]
* [[RXN-14192]]
+
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[4.2.1.59-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_6885]]
 +
*** [[Tiso_gene_6884]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[4.2.1.61-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_6884]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_10876]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_801]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-9514]]
 +
** 10 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_16579]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_10415]]
 +
*** [[Tiso_gene_624]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9515]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9518]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13083]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9520]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_6884]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_136]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-9521]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9524]]
 +
** 10 associated gene(s):
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_624]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_10415]]
 +
*** [[Tiso_gene_16579]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9526]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9528]]
 +
** 10 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_624]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_16579]]
 +
*** [[Tiso_gene_10415]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_9885]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9530]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9532]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9533]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_6884]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-9534]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_10778]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-9536]]
 +
** 10 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_10415]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_624]]
 +
*** [[Tiso_gene_16579]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9537]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_6884]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_9421]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_6885]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_6671]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9538]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_10778]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-9540]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9542]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_10778]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-9549]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9648]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_5939]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_136]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9650]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_5939]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9651]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_5939]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9652]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_5939]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9653]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_5939]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_136]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9654]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_5939]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9655]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_6884]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN3O-9780]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 2793-06-8
+
{{#set: taxonomic range=TAX-33154}}
* METABOLIGHTS : MTBLC57667
+
{{#set: common name=palmitate biosynthesis I (animals and fungi)}}
* PUBCHEM:
+
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21125569 21125569]
+
{{#set: reaction found=31}}
* HMDB : HMDB01508
+
{{#set: total reaction=31}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00206 C00206]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.19992628.html 19992628]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57667 57667]
+
* BIGG : dadp
+
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP([O-])([O-])=O)([O-])=O}}
+
{{#set: inchi key=InChIKey=DAEAPNUQQAICNR-RRKCRQDMSA-K}}
+
{{#set: common name=dADP}}
+
{{#set: molecular weight=408.18    }}
+
{{#set: common name=2'-deoxyadenosine-5'-diphosphate|deoxyadenosine-diphosphate}}
+
{{#set: consumed by=DADPKIN-RXN|NDPKm|RXN-14215|NDPK}}
+
{{#set: produced by=DEOXYADENYLATE-KINASE-RXN|ADPREDUCT-RXN|ATDAM|DATUP|DATCY|RXN-14214|RXN0-747}}
+
{{#set: consumed or produced by=RXN-14192}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-5994

  • taxonomic range:
  • common name:
    • palmitate biosynthesis I (animals and fungi)
  • Synonym(s):
    • palmitic acid biosynthesis
    • de novo lipogenesis

Reaction(s) found

31 reactions found over 31 reactions in the full pathway

Reaction(s) not found

External links