Difference between revisions of "HACD5"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_135 == * left end position: ** 36442 * transcription direction: ** POSITIVE * right end position: ** 37505 * centisome position: ** 89.6041...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_135 == |
− | * | + | * left end position: |
− | ** | + | ** 36442 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 37505 |
− | * | + | * centisome position: |
− | ** | + | ** 89.60413 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.3.1.165-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | * [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[3-OXOACYL-ACP-REDUCT-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[3-OXOACYL-ACP-SYNTH-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[4.2.1.58-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[4.2.1.59-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[4.2.1.61-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[ACP-S-ACETYLTRANSFER-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[ACYLCOASYN-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[ENOYL-ACP-REDUCT-NADPH-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[FATTY-ACYL-COA-SYNTHASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[LINOLENOYL-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[R223-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12184]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12560]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12978]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-13008]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-13279]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-13290]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-13614]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16380]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16389]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16393]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16401]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16402]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16415]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16418]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-5901]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-7904]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9514]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9515]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9518]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9520]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9521]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9524]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9526]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9528]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9530]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9532]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9533]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9534]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9535]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9536]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9537]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9538]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9540]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9542]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9623]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9633]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9634]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9644]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9648]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9650]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9651]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9652]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9653]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9654]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9655]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9673]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-7238]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-7239]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-7248]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN3O-1803]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN3O-5293]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN3O-5304]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN66-469]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN66-477]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN66-480]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN66-483]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN66-484]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[TRANS-RXN0-623]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6920]] | ||
+ | * [[PWY-7664]] | ||
+ | * [[P221-PWY]] | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-321]] | ||
+ | * [[PWY-5972]] | ||
+ | * [[PWY-5970]] | ||
+ | * [[PWY-5971]] | ||
+ | * [[PWY-7033]] | ||
+ | * [[PWY-5676]] | ||
+ | * [[PWY-5136]] | ||
+ | * [[PWY66-389]] | ||
+ | * [[PWY-7288]] | ||
+ | * [[PWY-4381]] | ||
+ | * [[PWY-7490]] | ||
+ | * [[PWY-6733]] | ||
+ | * [[PWY-7094]] | ||
+ | * [[PWY66-391]] | ||
+ | * [[PWY0-862]] | ||
+ | * [[PWY-5994]] | ||
+ | * [[PWY3O-355]] | ||
+ | * [[FAO-PWY]] | ||
+ | * [[PWY-1121]] | ||
+ | * [[PWY-6873]] | ||
+ | * [[PWY-5965]] | ||
+ | * [[PWY-5966]] | ||
+ | * [[PWY-5143]] | ||
+ | * [[FASYN-INITIAL-PWY]] | ||
+ | * [[PWY-5885]] | ||
+ | * [[PWY-7724]] | ||
+ | * [[PWY-5741]] | ||
+ | * [[FASYN-ELONG-PWY]] | ||
+ | * [[PWY-6001]] | ||
+ | * [[PWY-7216]] | ||
+ | * [[PWY-5147]] | ||
+ | * [[PWY-7049]] | ||
+ | * [[PWY-6799]] | ||
+ | * [[PWY-6000]] | ||
+ | * [[PWY66-387]] | ||
+ | * [[PWY-5989]] | ||
+ | * [[PWY1-3]] | ||
+ | * [[PWY-6803]] | ||
+ | * [[PWY66-388]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=36442}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=37505}} | |
− | + | {{#set: centisome position=89.60413 }} | |
− | {{#set: | + | {{#set: reaction associated=2.3.1.165-RXN|3-HYDROXYDECANOYL-ACP-DEHYDR-RXN|3-OXOACYL-ACP-REDUCT-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|3-OXOACYL-ACP-SYNTH-RXN|4.2.1.58-RXN|4.2.1.59-RXN|4.2.1.61-RXN|ACP-S-ACETYLTRANSFER-RXN|ACYLCOASYN-RXN|ENOYL-ACP-REDUCT-NADPH-RXN|FATTY-ACYL-COA-SYNTHASE-RXN|LINOLENOYL-RXN|MALONYL-COA-ACP-TRANSACYL-RXN|PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN|R223-RXN|RXN-12184|RXN-12560|RXN-12978|RXN-13008|RXN-13279|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-5901|RXN-7904|RXN-9514|RXN-9515|RXN-9518|RXN-9520|RXN-9521|RXN-9524|RXN-9526|RXN-9528|RXN-9530|RXN-9532|RXN-9533|RXN-9534|RXN-9535|RXN-9536|RXN-9537|RXN-9538|RXN-9540|RXN-9542|RXN-9623|RXN-9633|RXN-9634|RXN-9644|RXN-9648|RXN-9650|RXN-9651|RXN-9652|RXN-9653|RXN-9654|RXN-9655|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN3O-1803|RXN3O-5293|RXN3O-5304|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6920|PWY-7664|P221-PWY|PWY-7388|PWY-321|PWY-5972|PWY-5970|PWY-5971|PWY-7033|PWY-5676|PWY-5136|PWY66-389|PWY-7288|PWY-4381|PWY-7490|PWY-6733|PWY-7094|PWY66-391|PWY0-862|PWY-5994|PWY3O-355|FAO-PWY|PWY-1121|PWY-6873|PWY-5965|PWY-5966|PWY-5143|FASYN-INITIAL-PWY|PWY-5885|PWY-7724|PWY-5741|FASYN-ELONG-PWY|PWY-6001|PWY-7216|PWY-5147|PWY-7049|PWY-6799|PWY-6000|PWY66-387|PWY-5989|PWY1-3|PWY-6803|PWY66-388}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:27, 18 March 2018
Gene Tiso_gene_135
- left end position:
- 36442
- transcription direction:
- POSITIVE
- right end position:
- 37505
- centisome position:
- 89.60413
- Synonym(s):
Reactions associated
- 2.3.1.165-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 3-HYDROXYDECANOYL-ACP-DEHYDR-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 3-OXOACYL-ACP-REDUCT-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 3-OXOACYL-ACP-SYNTH-BASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 3-OXOACYL-ACP-SYNTH-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 4.2.1.58-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 4.2.1.59-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- 4.2.1.61-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- ACP-S-ACETYLTRANSFER-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- ACYLCOASYN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- ENOYL-ACP-REDUCT-NADPH-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- FATTY-ACYL-COA-SYNTHASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- LINOLENOYL-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- MALONYL-COA-ACP-TRANSACYL-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- R223-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12184
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12560
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12978
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13008
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13279
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13290
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13614
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16380
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16389
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16393
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16401
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16402
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16415
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16418
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-5901
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-7904
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9514
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9515
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9518
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9520
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9521
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9524
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9526
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9528
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9530
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9532
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9533
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9534
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9535
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9536
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9537
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9538
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9540
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9542
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9623
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9633
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9634
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9644
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9648
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9650
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9651
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9652
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9653
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9654
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9655
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9673
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN0-7238
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN0-7239
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN0-7248
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN3O-1803
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN3O-5293
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN3O-5304
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN66-469
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN66-477
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN66-480
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN66-483
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN66-484
- in-silico_annotation
- ec-number
- in-silico_annotation
- TRANS-RXN0-623
- in-silico_annotation
- ec-number
- in-silico_annotation
Pathways associated
- PWY-6920
- PWY-7664
- P221-PWY
- PWY-7388
- PWY-321
- PWY-5972
- PWY-5970
- PWY-5971
- PWY-7033
- PWY-5676
- PWY-5136
- PWY66-389
- PWY-7288
- PWY-4381
- PWY-7490
- PWY-6733
- PWY-7094
- PWY66-391
- PWY0-862
- PWY-5994
- PWY3O-355
- FAO-PWY
- PWY-1121
- PWY-6873
- PWY-5965
- PWY-5966
- PWY-5143
- FASYN-INITIAL-PWY
- PWY-5885
- PWY-7724
- PWY-5741
- FASYN-ELONG-PWY
- PWY-6001
- PWY-7216
- PWY-5147
- PWY-7049
- PWY-6799
- PWY-6000
- PWY66-387
- PWY-5989
- PWY1-3
- PWY-6803
- PWY66-388