Difference between revisions of "THF"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** palmitate biosynthesis II (bacteria and plants) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** palmitic acid biosynthesis |
+ | ** de novo lipogenesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''31''' reaction(s) found | |
− | * [[ | + | ** [[4.2.1.59-RXN]] |
− | == Reaction(s) | + | ** [[4.2.1.61-RXN]] |
+ | ** [[4.2.1.58-RXN]] | ||
+ | ** [[RXN-9659]] | ||
+ | ** [[RXN-9658]] | ||
+ | ** [[RXN-9657]] | ||
+ | ** [[RXN-9655]] | ||
+ | ** [[RXN-9520]] | ||
+ | ** [[RXN-9523]] | ||
+ | ** [[RXN-9524]] | ||
+ | ** [[RXN-9527]] | ||
+ | ** [[RXN-9540]] | ||
+ | ** [[RXN-9528]] | ||
+ | ** [[RXN-9549]] | ||
+ | ** [[RXN-16393]] | ||
+ | ** [[RXN-9662]] | ||
+ | ** [[RXN-9663]] | ||
+ | ** [[RXN-9660]] | ||
+ | ** [[RXN-9661]] | ||
+ | ** [[RXN-9514]] | ||
+ | ** [[RXN-9518]] | ||
+ | ** [[RXN-9623]] | ||
+ | ** [[3.1.2.21-RXN]] | ||
+ | ** [[RXN-9539]] | ||
+ | ** [[RXN-9536]] | ||
+ | ** [[RXN-9537]] | ||
+ | ** [[RXN-9535]] | ||
+ | ** [[RXN-9532]] | ||
+ | ** [[RXN-9533]] | ||
+ | ** [[RXN-9516]] | ||
+ | ** [[RXN-9531]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5971 PWY-5971] | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=palmitate biosynthesis II (bacteria and plants)}} | |
− | + | {{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}} | |
− | + | {{#set: reaction found=31}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:21, 10 January 2018
Pathway PWY-5971
- taxonomic range:
- common name:
- palmitate biosynthesis II (bacteria and plants)
- Synonym(s):
- palmitic acid biosynthesis
- de novo lipogenesis
Reaction(s) found
- 31 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
External links
- ECOCYC: